C12H20O3 — CID 15541901
2-[(1S,5R)-1-hydroxy-5-methyl-2-propan-2-ylidenecyclohexyl]acetic acid (PubChem CID 15541901) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-[(1S,5R)-1-hydroxy-5-methyl-2-propan-2-ylidenecyclohexyl]acetic acid.
| Compound Name | 2-[(1S,5R)-1-hydroxy-5-methyl-2-propan-2-ylidenecyclohexyl]acetic acid |
|---|---|
| PubChem CID | 15541901 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-[(1S,5R)-1-hydroxy-5-methyl-2-propan-2-ylidenecyclohexyl]acetic acid |
| SMILES | CC(C)=C1CC[C@@H](C)C[C@]1(O)CC(=O)O |
| InChI | InChI=1S/C12H20O3/c1-8(2)10-5-4-9(3)6-12(10,15)7-11(13)14/h9,15H,4-7H2,1-3H3,(H,13,14)/t9-,12+/m1/s1 |
| InChIKey | PEJNNBXBMPVRPA-SKDRFNHKSA-N |
| XLogP | 2.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|