C14H22F2O3 — CID 66038828
ethyl 2,2-difluoro-2-(1-hydroxy-5-methyl-2-propan-2-ylidenecyclohexyl)acetate (PubChem CID 66038828) has the molecular formula C14H22F2O3 and a molecular weight of 276.32 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(1-hydroxy-5-methyl-2-propan-2-ylidenecyclohexyl)acetate.
| Compound Name | ethyl 2,2-difluoro-2-(1-hydroxy-5-methyl-2-propan-2-ylidenecyclohexyl)acetate |
|---|---|
| PubChem CID | 66038828 |
| Molecular Formula | C14H22F2O3 |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | ethyl 2,2-difluoro-2-(1-hydroxy-5-methyl-2-propan-2-ylidenecyclohexyl)acetate |
| SMILES | CCOC(=O)C(F)(F)C1(O)CC(C)CCC1=C(C)C |
| InChI | InChI=1S/C14H22F2O3/c1-5-19-12(17)14(15,16)13(18)8-10(4)6-7-11(13)9(2)3/h10,18H,5-8H2,1-4H3 |
| InChIKey | CCGSSPYSIVEIHL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|