About 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid
2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid (PubChem CID 21399062) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid |
| PubChem CID | 21399062 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid |
| SMILES | CC(C)CCCC(C)CC1=CC(O)(CC(=O)O)CC1 |
| InChI | InChI=1S/C16H28O3/c1-12(2)5-4-6-13(3)9-14-7-8-16(19,10-14)11-15(17)18/h10,12-13,19H,4-9,11H2,1-3H3,(H,17,18) |
| InChIKey | FFFGYIGAGYJWFF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid?
The IUPAC name of 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid (CID 21399062) is 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid.
What is the SMILES notation for 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid?
The canonical SMILES for 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid is CC(C)CCCC(C)CC1=CC(O)(CC(=O)O)CC1.
What is the InChIKey of 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid?
The InChIKey is FFFGYIGAGYJWFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-12(2)5-4-6-13(3)9-14-7-8-16(19,10-14)11-15(17)18/h10,12-13,19H,4-9,11H2,1-3H3,(H,17,18).
What are the key properties of 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid?
2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid has a molecular weight of 268.40 g/mol, XLogP of 3.76, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid is sourced from PubChem (CID 21399062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).