C16H28O3 — CID 21399062
2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid (PubChem CID 21399062) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 21399062 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2-[3-(2,6-dimethylheptyl)-1-hydroxycyclopent-2-en-1-yl]acetic acid |
| SMILES | CC(C)CCCC(C)CC1=CC(O)(CC(=O)O)CC1 |
| InChI | InChI=1S/C16H28O3/c1-12(2)5-4-6-13(3)9-14-7-8-16(19,10-14)11-15(17)18/h10,12-13,19H,4-9,11H2,1-3H3,(H,17,18) |
| InChIKey | FFFGYIGAGYJWFF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|