C16H22O3 — CID 135014214
(3R)-3-[(S)-hydroxy(phenyl)methyl]-2,2,6,6-tetramethyloxan-4-one (PubChem CID 135014214) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (3R)-3-[(S)-hydroxy(phenyl)methyl]-2,2,6,6-tetramethyloxan-4-one.
| Compound Name | (3R)-3-[(S)-hydroxy(phenyl)methyl]-2,2,6,6-tetramethyloxan-4-one |
|---|---|
| PubChem CID | 135014214 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (3R)-3-[(S)-hydroxy(phenyl)methyl]-2,2,6,6-tetramethyloxan-4-one |
| SMILES | CC1(C)CC(=O)[C@H]([C@H](O)c2ccccc2)C(C)(C)O1 |
| InChI | InChI=1S/C16H22O3/c1-15(2)10-12(17)13(16(3,4)19-15)14(18)11-8-6-5-7-9-11/h5-9,13-14,18H,10H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | DLDLVEUZSVQONF-ZIAGYGMSSA-N |
| XLogP | 2.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |