C24H29NO2 — CID 135014701
ethyl 5,5-dideuterio-2-methyl-3-methylidene-2-(C-methyl-N-phenylcarbonimidoyl)-6-phenylhexanoate (PubChem CID 135014701) has the molecular formula C24H29NO2 and a molecular weight of 365.51 g/mol. Its IUPAC name is ethyl 5,5-dideuterio-2-methyl-3-methylidene-2-(C-methyl-N-phenylcarbonimidoyl)-6-phenylhexanoate.
| Compound Name | ethyl 5,5-dideuterio-2-methyl-3-methylidene-2-(C-methyl-N-phenylcarbonimidoyl)-6-phenylhexanoate |
|---|---|
| PubChem CID | 135014701 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | ethyl 5,5-dideuterio-2-methyl-3-methylidene-2-(C-methyl-N-phenylcarbonimidoyl)-6-phenylhexanoate |
| SMILES | [2H]C([2H])(CC(=C)C(C)(C(=O)OCC)/C(C)=N/c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c1-5-27-23(26)24(4,20(3)25-22-17-10-7-11-18-22)19(2)13-12-16-21-14-8-6-9-15-21/h6-11,14-15,17-18H,2,5,12-13,16H2,1,3-4H3/b25-20+/i12D2 |
| InChIKey | LEILEWGEWAKGIZ-JVVBDKIBSA-N |
| XLogP | 5.93 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|