C11H9F2NO2 — CID 135014950
(4R)-3-(2,2-difluoroethenyl)-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 135014950) has the molecular formula C11H9F2NO2 and a molecular weight of 225.19 g/mol. Its IUPAC name is (4R)-3-(2,2-difluoroethenyl)-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-(2,2-difluoroethenyl)-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135014950 |
| Molecular Formula | C11H9F2NO2 |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (4R)-3-(2,2-difluoroethenyl)-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N1C=C(F)F |
| InChI | InChI=1S/C11H9F2NO2/c12-10(13)6-14-9(7-16-11(14)15)8-4-2-1-3-5-8/h1-6,9H,7H2/t9-/m0/s1 |
| InChIKey | VKIUZEJKWLKSIG-VIFPVBQESA-N |
| XLogP | 2.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |