C16H13N3O3 — CID 135015044
N-[4-(1,3-dioxoisoindol-2-yl)-2-methyl-3-pyridinyl]acetamide (PubChem CID 135015044) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is N-[4-(1,3-dioxoisoindol-2-yl)-2-methyl-3-pyridinyl]acetamide.
| Compound Name | N-[4-(1,3-dioxoisoindol-2-yl)-2-methyl-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 135015044 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[4-(1,3-dioxoisoindol-2-yl)-2-methyl-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1c(N2C(=O)c3ccccc3C2=O)ccnc1C |
| InChI | InChI=1S/C16H13N3O3/c1-9-14(18-10(2)20)13(7-8-17-9)19-15(21)11-5-3-4-6-12(11)16(19)22/h3-8H,1-2H3,(H,18,20) |
| InChIKey | GCOVFFSVXYSVID-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|