C24H40O5 — CID 135015379
[(4R,5R,7R,8S,9R,10S,12E)-7-acetyloxy-4-ethyl-9-methoxy-8,10-dimethyltetradeca-2,12-dien-5-yl] prop-2-enoate (PubChem CID 135015379) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is [(4R,5R,7R,8S,9R,10S,12E)-7-acetyloxy-4-ethyl-9-methoxy-8,10-dimethyltetradeca-2,12-dien-5-yl] prop-2-enoate.
| Compound Name | [(4R,5R,7R,8S,9R,10S,12E)-7-acetyloxy-4-ethyl-9-methoxy-8,10-dimethyltetradeca-2,12-dien-5-yl] prop-2-enoate |
|---|---|
| PubChem CID | 135015379 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | [(4R,5R,7R,8S,9R,10S,12E)-7-acetyloxy-4-ethyl-9-methoxy-8,10-dimethyltetradeca-2,12-dien-5-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@H](C[C@@H](OC(C)=O)[C@H](C)[C@H](OC)[C@@H](C)C/C=C/C)[C@@H](C=CC)CC |
| InChI | InChI=1S/C24H40O5/c1-9-13-15-17(5)24(27-8)18(6)21(28-19(7)25)16-22(29-23(26)12-4)20(11-3)14-10-2/h9-10,12-14,17-18,20-22,24H,4,11,15-16H2,1-3,5-8H3/b13-9+,14-10?/t17-,18-,20+,21+,22+,24+/m0/s1 |
| InChIKey | XBRFMGQDSHKXBO-SXYYEFNCSA-N |
| XLogP | 5.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|