C26H27N3O2 — CID 135015723
(3Z)-1-benzyl-6-methyl-3-[[2-(3-methylbut-2-enyl)-1H-indol-3-yl]methylidene]piperazine-2,5-dione (PubChem CID 135015723) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is (3Z)-1-benzyl-6-methyl-3-[[2-(3-methylbut-2-enyl)-1H-indol-3-yl]methylidene]piperazine-2,5-dione.
| Compound Name | (3Z)-1-benzyl-6-methyl-3-[[2-(3-methylbut-2-enyl)-1H-indol-3-yl]methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 135015723 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (3Z)-1-benzyl-6-methyl-3-[[2-(3-methylbut-2-enyl)-1H-indol-3-yl]methylidene]piperazine-2,5-dione |
| SMILES | CC(C)=CCc1[nH]c2ccccc2c1/C=C1\NC(=O)C(C)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C26H27N3O2/c1-17(2)13-14-23-21(20-11-7-8-12-22(20)27-23)15-24-26(31)29(18(3)25(30)28-24)16-19-9-5-4-6-10-19/h4-13,15,18,27H,14,16H2,1-3H3,(H,28,30)/b24-15- |
| InChIKey | PFAUQPJBSLDOJV-IWIPYMOSSA-N |
| XLogP | 4.56 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|