C14H18O7 — CID 135016019
methyl 2-[(2S)-1-[(2-methylpropan-2-yl)oxy]-1,4-dioxobutan-2-yl]-5-oxofuran-2-carboxylate (PubChem CID 135016019) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is methyl 2-[(2S)-1-[(2-methylpropan-2-yl)oxy]-1,4-dioxobutan-2-yl]-5-oxofuran-2-carboxylate.
| Compound Name | methyl 2-[(2S)-1-[(2-methylpropan-2-yl)oxy]-1,4-dioxobutan-2-yl]-5-oxofuran-2-carboxylate |
|---|---|
| PubChem CID | 135016019 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | methyl 2-[(2S)-1-[(2-methylpropan-2-yl)oxy]-1,4-dioxobutan-2-yl]-5-oxofuran-2-carboxylate |
| SMILES | COC(=O)C1([C@H](CC=O)C(=O)OC(C)(C)C)C=CC(=O)O1 |
| InChI | InChI=1S/C14H18O7/c1-13(2,3)21-11(17)9(6-8-15)14(12(18)19-4)7-5-10(16)20-14/h5,7-9H,6H2,1-4H3/t9-,14?/m1/s1 |
| InChIKey | DNHYXVNMYREVGV-UCWRFOARSA-N |
| XLogP | 0.56 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|