C15H16O11 — CID 102257114
dimethyl 2-(2-methoxy-2-oxoethyl)-4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-5-oxofuran-2,3-dicarboxylate (PubChem CID 102257114) has the molecular formula C15H16O11 and a molecular weight of 372.28 g/mol. Its IUPAC name is dimethyl 2-(2-methoxy-2-oxoethyl)-4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-5-oxofuran-2,3-dicarboxylate.
| Compound Name | dimethyl 2-(2-methoxy-2-oxoethyl)-4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-5-oxofuran-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102257114 |
| Molecular Formula | C15H16O11 |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | dimethyl 2-(2-methoxy-2-oxoethyl)-4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-5-oxofuran-2,3-dicarboxylate |
| SMILES | COC(=O)/C=C/OC1=C(C(=O)OC)C(CC(=O)OC)(C(=O)OC)OC1=O |
| InChI | InChI=1S/C15H16O11/c1-21-8(16)5-6-25-11-10(12(18)23-3)15(14(20)24-4,26-13(11)19)7-9(17)22-2/h5-6H,7H2,1-4H3/b6-5+ |
| InChIKey | RCNYEBSIZXNEDT-AATRIKPKSA-N |
| XLogP | -0.85 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|