C24H38O10 — CID 101164675
tetratert-butyl (2S,3R)-3-hydroxy-2H-furan-2,3,4,5-tetracarboxylate (PubChem CID 101164675) has the molecular formula C24H38O10 and a molecular weight of 486.56 g/mol. Its IUPAC name is tetratert-butyl (2S,3R)-3-hydroxy-2H-furan-2,3,4,5-tetracarboxylate.
| Compound Name | tetratert-butyl (2S,3R)-3-hydroxy-2H-furan-2,3,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 101164675 |
| Molecular Formula | C24H38O10 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | tetratert-butyl (2S,3R)-3-hydroxy-2H-furan-2,3,4,5-tetracarboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=O)OC(C)(C)C)[C@](O)(C(=O)OC(C)(C)C)[C@@H](C(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C24H38O10/c1-20(2,3)31-16(25)13-14(17(26)32-21(4,5)6)30-15(18(27)33-22(7,8)9)24(13,29)19(28)34-23(10,11)12/h15,29H,1-12H3/t15-,24-/m1/s1 |
| InChIKey | FYQIGWVIDFXKAM-OYLFLEFRSA-N |
| XLogP | 2.74 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|