C26H38O9 — CID 139589919
(1R,2S)-1-[(2E,6E,10E,14E)-15-carboxy-3,7,11-trimethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2,3-tricarboxylic acid (PubChem CID 139589919) has the molecular formula C26H38O9 and a molecular weight of 494.58 g/mol. Its IUPAC name is (1R,2S)-1-[(2E,6E,10E,14E)-15-carboxy-3,7,11-trimethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2,3-tricarboxylic acid.
| Compound Name | (1R,2S)-1-[(2E,6E,10E,14E)-15-carboxy-3,7,11-trimethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 139589919 |
| Molecular Formula | C26H38O9 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | (1R,2S)-1-[(2E,6E,10E,14E)-15-carboxy-3,7,11-trimethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2,3-tricarboxylic acid |
| SMILES | C/C(=C\CC/C(C)=C/CO[C@@H](C(=O)O)C(CC(=O)O)C(=O)O)CC/C=C(\C)CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C26H38O9/c1-17(8-5-9-18(2)12-7-13-20(4)24(29)30)10-6-11-19(3)14-15-35-23(26(33)34)21(25(31)32)16-22(27)28/h9-10,13-14,21,23H,5-8,11-12,15-16H2,1-4H3,(H,27,28)(H,29,30)(H,31,32)(H,33,34)/b17-10+,18-9+,19-14+,20-13+/t21?,23-/m1/s1 |
| InChIKey | GGBZDYXEXJJNIW-GFNHFQDZSA-N |
| XLogP | 4.84 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|