C26H40O8 — CID 139589920
(1R,2S)-1-[(2E,6E,10E,14E)-16-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2,3-tricarboxylic acid (PubChem CID 139589920) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is (1R,2S)-1-[(2E,6E,10E,14E)-16-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2,3-tricarboxylic acid.
| Compound Name | (1R,2S)-1-[(2E,6E,10E,14E)-16-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 139589920 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (1R,2S)-1-[(2E,6E,10E,14E)-16-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2,3-tricarboxylic acid |
| SMILES | C/C(=C\CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CO[C@@H](C(=O)O)C(CC(=O)O)C(=O)O)CO |
| InChI | InChI=1S/C26H40O8/c1-18(8-5-9-19(2)11-7-13-21(4)17-27)10-6-12-20(3)14-15-34-24(26(32)33)22(25(30)31)16-23(28)29/h9-10,13-14,22,24,27H,5-8,11-12,15-17H2,1-4H3,(H,28,29)(H,30,31)(H,32,33)/b18-10+,19-9+,20-14+,21-13+/t22?,24-/m1/s1 |
| InChIKey | LJSMEPMKRGALRR-RHTRRCSVSA-N |
| XLogP | 4.75 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|