C29H46O11 — CID 72714572
1-[(4Z,6E)-4-carboxy-2,6,8,10,12,14-hexamethylhexadeca-4,6-dienoyl]oxy-3-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 72714572) has the molecular formula C29H46O11 and a molecular weight of 570.68 g/mol. Its IUPAC name is 1-[(4Z,6E)-4-carboxy-2,6,8,10,12,14-hexamethylhexadeca-4,6-dienoyl]oxy-3-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 1-[(4Z,6E)-4-carboxy-2,6,8,10,12,14-hexamethylhexadeca-4,6-dienoyl]oxy-3-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 72714572 |
| Molecular Formula | C29H46O11 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | 1-[(4Z,6E)-4-carboxy-2,6,8,10,12,14-hexamethylhexadeca-4,6-dienoyl]oxy-3-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCC(C)CC(C)CC(C)CC(C)/C=C(C)/C=C(/CC(C)C(=O)OC(C(=O)O)C(C(=O)O)C(O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C29H46O11/c1-8-15(2)9-16(3)10-17(4)11-18(5)12-19(6)13-21(25(31)32)14-20(7)29(39)40-24(28(37)38)22(26(33)34)23(30)27(35)36/h12-13,15-18,20,22-24,30H,8-11,14H2,1-7H3,(H,31,32)(H,33,34)(H,35,36)(H,37,38)/b19-12+,21-13- |
| InChIKey | RYHLPYRPLBYVDJ-VVPWPQJISA-N |
| XLogP | 4.24 |
| TPSA | 195.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|