C10H8O13 — CID 54425984
3-hydroxy-1-oxalooxybut-1-ene-1,2,3,4-tetracarboxylic acid (PubChem CID 54425984) has the molecular formula C10H8O13 and a molecular weight of 336.16 g/mol. Its IUPAC name is 3-hydroxy-1-oxalooxybut-1-ene-1,2,3,4-tetracarboxylic acid.
| Compound Name | 3-hydroxy-1-oxalooxybut-1-ene-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 54425984 |
| Molecular Formula | C10H8O13 |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 3-hydroxy-1-oxalooxybut-1-ene-1,2,3,4-tetracarboxylic acid |
| SMILES | O=C(O)CC(O)(C(=O)O)C(C(=O)O)=C(OC(=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H8O13/c11-2(12)1-10(22,9(20)21)3(5(13)14)4(6(15)16)23-8(19)7(17)18/h22H,1H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)(H,20,21) |
| InChIKey | WECPJYROXFSBLB-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 233.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|