C14H21BrO4 — CID 135016575
methyl (2S)-2-[(1R,2S)-2-(bromomethyl)cyclohexyl]-2-[(3S)-5-oxooxolan-3-yl]acetate (PubChem CID 135016575) has the molecular formula C14H21BrO4 and a molecular weight of 333.22 g/mol. Its IUPAC name is methyl (2S)-2-[(1R,2S)-2-(bromomethyl)cyclohexyl]-2-[(3S)-5-oxooxolan-3-yl]acetate.
| Compound Name | methyl (2S)-2-[(1R,2S)-2-(bromomethyl)cyclohexyl]-2-[(3S)-5-oxooxolan-3-yl]acetate |
|---|---|
| PubChem CID | 135016575 |
| Molecular Formula | C14H21BrO4 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | methyl (2S)-2-[(1R,2S)-2-(bromomethyl)cyclohexyl]-2-[(3S)-5-oxooxolan-3-yl]acetate |
| SMILES | COC(=O)[C@H]([C@H]1COC(=O)C1)[C@H]1CCCC[C@@H]1CBr |
| InChI | InChI=1S/C14H21BrO4/c1-18-14(17)13(10-6-12(16)19-8-10)11-5-3-2-4-9(11)7-15/h9-11,13H,2-8H2,1H3/t9-,10-,11+,13-/m1/s1 |
| InChIKey | JNSGTZXHSVDQQP-HNCHTBHHSA-N |
| XLogP | 2.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|