C14H21IO4 — CID 135016649
methyl 2-[(3S,4S)-4-[(1R,2S)-2-(iodomethyl)cyclohexyl]-5-oxooxolan-3-yl]acetate (PubChem CID 135016649) has the molecular formula C14H21IO4 and a molecular weight of 380.22 g/mol. Its IUPAC name is methyl 2-[(3S,4S)-4-[(1R,2S)-2-(iodomethyl)cyclohexyl]-5-oxooxolan-3-yl]acetate.
| Compound Name | methyl 2-[(3S,4S)-4-[(1R,2S)-2-(iodomethyl)cyclohexyl]-5-oxooxolan-3-yl]acetate |
|---|---|
| PubChem CID | 135016649 |
| Molecular Formula | C14H21IO4 |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | methyl 2-[(3S,4S)-4-[(1R,2S)-2-(iodomethyl)cyclohexyl]-5-oxooxolan-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1COC(=O)[C@H]1[C@H]1CCCC[C@@H]1CI |
| InChI | InChI=1S/C14H21IO4/c1-18-12(16)6-10-8-19-14(17)13(10)11-5-3-2-4-9(11)7-15/h9-11,13H,2-8H2,1H3/t9-,10-,11+,13-/m1/s1 |
| InChIKey | LJTGVLPTFCRMTN-HNCHTBHHSA-N |
| XLogP | 2.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|