C9H12N2 — CID 135017072
(Z)-2-isocyano-3,5-dimethylhex-2-enenitrile (PubChem CID 135017072) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (Z)-2-isocyano-3,5-dimethylhex-2-enenitrile.
| Compound Name | (Z)-2-isocyano-3,5-dimethylhex-2-enenitrile |
|---|---|
| PubChem CID | 135017072 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (Z)-2-isocyano-3,5-dimethylhex-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C(/C)CC(C)C |
| InChI | InChI=1S/C9H12N2/c1-7(2)5-8(3)9(6-10)11-4/h7H,5H2,1-3H3/b9-8- |
| InChIKey | NZBFIXWMHSNYAQ-HJWRWDBZSA-N |
| XLogP | 2.75 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|