C36H38O4 — CID 135017080
methyl 2-[4-[4-(2-methoxycarbonyl-3,4,5,6-tetramethylphenyl)phenyl]phenyl]-3,4,5,6-tetramethylbenzoate (PubChem CID 135017080) has the molecular formula C36H38O4 and a molecular weight of 534.70 g/mol. Its IUPAC name is methyl 2-[4-[4-(2-methoxycarbonyl-3,4,5,6-tetramethylphenyl)phenyl]phenyl]-3,4,5,6-tetramethylbenzoate.
| Compound Name | methyl 2-[4-[4-(2-methoxycarbonyl-3,4,5,6-tetramethylphenyl)phenyl]phenyl]-3,4,5,6-tetramethylbenzoate |
|---|---|
| PubChem CID | 135017080 |
| Molecular Formula | C36H38O4 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | methyl 2-[4-[4-(2-methoxycarbonyl-3,4,5,6-tetramethylphenyl)phenyl]phenyl]-3,4,5,6-tetramethylbenzoate |
| SMILES | COC(=O)c1c(C)c(C)c(C)c(C)c1-c1ccc(-c2ccc(-c3c(C)c(C)c(C)c(C)c3C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C36H38O4/c1-19-21(3)25(7)33(35(37)39-9)31(23(19)5)29-15-11-27(12-16-29)28-13-17-30(18-14-28)32-24(6)20(2)22(4)26(8)34(32)36(38)40-10/h11-18H,1-10H3 |
| InChIKey | YJVNZAOKAWFLEK-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |