C17H23NSi2 — CID 135017408
trimethyl-(10-trimethylsilyl-3-azatricyclo[6.4.0.02,7]dodeca-1(12),2(7),3,5,8,10-hexaen-11-yl)silane (PubChem CID 135017408) has the molecular formula C17H23NSi2 and a molecular weight of 297.55 g/mol. Its IUPAC name is trimethyl-(10-trimethylsilyl-3-azatricyclo[6.4.0.02,7]dodeca-1(12),2(7),3,5,8,10-hexaen-11-yl)silane.
| Compound Name | trimethyl-(10-trimethylsilyl-3-azatricyclo[6.4.0.02,7]dodeca-1(12),2(7),3,5,8,10-hexaen-11-yl)silane |
|---|---|
| PubChem CID | 135017408 |
| Molecular Formula | C17H23NSi2 |
| Molecular Weight | 297.55 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | trimethyl-(10-trimethylsilyl-3-azatricyclo[6.4.0.02,7]dodeca-1(12),2(7),3,5,8,10-hexaen-11-yl)silane |
| SMILES | C[Si](C)(C)c1cc2c(cc1[Si](C)(C)C)-c1ncccc1-2 |
| InChI | InChI=1S/C17H23NSi2/c1-19(2,3)15-10-13-12-8-7-9-18-17(12)14(13)11-16(15)20(4,5)6/h7-11H,1-6H3 |
| InChIKey | MENKYNWSCMRSGE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|