C12H26O2 — CID 135017434
1,6-dimethoxy-3,7-dimethyloctane (PubChem CID 135017434) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 1,6-dimethoxy-3,7-dimethyloctane.
| Compound Name | 1,6-dimethoxy-3,7-dimethyloctane |
|---|---|
| PubChem CID | 135017434 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 1,6-dimethoxy-3,7-dimethyloctane |
| SMILES | COCCC(C)CCC(OC)C(C)C |
| InChI | InChI=1S/C12H26O2/c1-10(2)12(14-5)7-6-11(3)8-9-13-4/h10-12H,6-9H2,1-5H3 |
| InChIKey | SJOOVCSXJQGOIQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |