C22H27Cl3O2Si — CID 135018444
[3-chloro-5-tri(propan-2-yl)silyloxyphenyl]-(2,4-dichlorophenyl)methanone (PubChem CID 135018444) has the molecular formula C22H27Cl3O2Si and a molecular weight of 457.90 g/mol. Its IUPAC name is [3-chloro-5-tri(propan-2-yl)silyloxyphenyl]-(2,4-dichlorophenyl)methanone.
| Compound Name | [3-chloro-5-tri(propan-2-yl)silyloxyphenyl]-(2,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 135018444 |
| Molecular Formula | C22H27Cl3O2Si |
| Molecular Weight | 457.90 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | [3-chloro-5-tri(propan-2-yl)silyloxyphenyl]-(2,4-dichlorophenyl)methanone |
| SMILES | CC(C)[Si](Oc1cc(Cl)cc(C(=O)c2ccc(Cl)cc2Cl)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H27Cl3O2Si/c1-13(2)28(14(3)4,15(5)6)27-19-10-16(9-18(24)11-19)22(26)20-8-7-17(23)12-21(20)25/h7-15H,1-6H3 |
| InChIKey | XFNDYRCAOQORGI-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.90 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|