C24H38O7Si — CID 135018711
ethyl 2-[(2R,3aR,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-2-methylpropanoate (PubChem CID 135018711) has the molecular formula C24H38O7Si and a molecular weight of 466.65 g/mol. Its IUPAC name is ethyl 2-[(2R,3aR,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[(2R,3aR,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 135018711 |
| Molecular Formula | C24H38O7Si |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | ethyl 2-[(2R,3aR,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)C1(O)OC[C@H]2O[C@@H](c3ccccc3)O[C@H]2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H38O7Si/c1-9-27-21(25)23(5,6)24(26)19(31-32(7,8)22(2,3)4)18-17(15-28-24)29-20(30-18)16-13-11-10-12-14-16/h10-14,17-20,26H,9,15H2,1-8H3/t17-,18-,19-,20-,24?/m1/s1 |
| InChIKey | QJAMWCMGUMMLDG-LANQOTGMSA-N |
| XLogP | 4.17 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|