C26H39NO10Si — CID 135018750
[(3S,6S)-3,4-diacetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate (PubChem CID 135018750) has the molecular formula C26H39NO10Si and a molecular weight of 553.68 g/mol. Its IUPAC name is [(3S,6S)-3,4-diacetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(3S,6S)-3,4-diacetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135018750 |
| Molecular Formula | C26H39NO10Si |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | [(3S,6S)-3,4-diacetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](O[Si](C)(C)C(C)(C)C)C(NC(=O)OCc2ccccc2)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H39NO10Si/c1-16(28)32-15-20-22(34-17(2)29)23(35-18(3)30)21(24(36-20)37-38(7,8)26(4,5)6)27-25(31)33-14-19-12-10-9-11-13-19/h9-13,20-24H,14-15H2,1-8H3,(H,27,31)/t20?,21?,22-,23?,24+/m1/s1 |
| InChIKey | TUMAOLDJCMIWIT-MZBZACTISA-N |
| XLogP | 3.45 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|