C20H32O3 — CID 135018782
(1R,2R,3R,7S,8S,10S)-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,7,10-triol (PubChem CID 135018782) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1R,2R,3R,7S,8S,10S)-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,7,10-triol.
| Compound Name | (1R,2R,3R,7S,8S,10S)-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,7,10-triol |
|---|---|
| PubChem CID | 135018782 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1R,2R,3R,7S,8S,10S)-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,7,10-triol |
| SMILES | C=C1CC[C@H](O)[C@@]2(C)C[C@H](O)C3=C(C)CC[C@@H]([C@@H](O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C20H32O3/c1-11-6-8-13-18(23)17-12(2)7-9-15(22)20(17,5)10-14(21)16(11)19(13,3)4/h13-15,17-18,21-23H,2,6-10H2,1,3-5H3/t13-,14-,15-,17-,18+,20+/m0/s1 |
| InChIKey | WWEXOKPRQVYFKQ-ASURLCBNSA-N |
| XLogP | 3.20 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|