C22H46OSi — CID 135020117
[(1R,2R,5S)-2,5-diethyl-2-(2-methylpropyl)cyclopentyl]oxy-tri(propan-2-yl)silane (PubChem CID 135020117) has the molecular formula C22H46OSi and a molecular weight of 354.70 g/mol. Its IUPAC name is [(1R,2R,5S)-2,5-diethyl-2-(2-methylpropyl)cyclopentyl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1R,2R,5S)-2,5-diethyl-2-(2-methylpropyl)cyclopentyl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 135020117 |
| Molecular Formula | C22H46OSi |
| Molecular Weight | 354.70 g/mol |
| Exact Mass | 354.33 |
| IUPAC Name | [(1R,2R,5S)-2,5-diethyl-2-(2-methylpropyl)cyclopentyl]oxy-tri(propan-2-yl)silane |
| SMILES | CC[C@H]1CC[C@](CC)(CC(C)C)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H46OSi/c1-11-20-13-14-22(12-2,15-16(3)4)21(20)23-24(17(5)6,18(7)8)19(9)10/h16-21H,11-15H2,1-10H3/t20-,21+,22+/m0/s1 |
| InChIKey | OXRSZGZVTDCARK-BHDDXSALSA-N |
| XLogP | 7.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.70 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|