C20H34OSi — CID 135020612
(1R)-1-cyclohexyl-5-tri(propan-2-yl)silylpenta-2,4-diyn-1-ol (PubChem CID 135020612) has the molecular formula C20H34OSi and a molecular weight of 318.58 g/mol. Its IUPAC name is (1R)-1-cyclohexyl-5-tri(propan-2-yl)silylpenta-2,4-diyn-1-ol.
| Compound Name | (1R)-1-cyclohexyl-5-tri(propan-2-yl)silylpenta-2,4-diyn-1-ol |
|---|---|
| PubChem CID | 135020612 |
| Molecular Formula | C20H34OSi |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (1R)-1-cyclohexyl-5-tri(propan-2-yl)silylpenta-2,4-diyn-1-ol |
| SMILES | CC(C)[Si](C#CC#C[C@H](O)C1CCCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H34OSi/c1-16(2)22(17(3)4,18(5)6)15-11-10-14-20(21)19-12-8-7-9-13-19/h16-21H,7-9,12-13H2,1-6H3/t20-/m0/s1 |
| InChIKey | GAKJZAPJSIOKJM-FQEVSTJZSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|