C20H42OSi2 — CID 135021402
triethyl-[(Z)-3-[(E)-2-methylbut-2-enoxy]-1-triethylsilylprop-2-enyl]silane (PubChem CID 135021402) has the molecular formula C20H42OSi2 and a molecular weight of 354.73 g/mol. Its IUPAC name is triethyl-[(Z)-3-[(E)-2-methylbut-2-enoxy]-1-triethylsilylprop-2-enyl]silane.
| Compound Name | triethyl-[(Z)-3-[(E)-2-methylbut-2-enoxy]-1-triethylsilylprop-2-enyl]silane |
|---|---|
| PubChem CID | 135021402 |
| Molecular Formula | C20H42OSi2 |
| Molecular Weight | 354.73 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | triethyl-[(Z)-3-[(E)-2-methylbut-2-enoxy]-1-triethylsilylprop-2-enyl]silane |
| SMILES | C/C=C(\C)CO/C=C\C([Si](CC)(CC)CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H42OSi2/c1-9-19(8)18-21-17-16-20(22(10-2,11-3)12-4)23(13-5,14-6)15-7/h9,16-17,20H,10-15,18H2,1-8H3/b17-16-,19-9+ |
| InChIKey | MNKIZCIBSKLSSN-XCADENKESA-N |
| XLogP | 7.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.73 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|