C23H29N2O3+ — CID 135021740
methyl 1-butyl-3-[(4-methoxyphenyl)methyl]-5-phenyl-4,5-dihydroimidazol-3-ium-4-carboxylate (PubChem CID 135021740) has the molecular formula C23H29N2O3+ and a molecular weight of 381.50 g/mol. Its IUPAC name is methyl 1-butyl-3-[(4-methoxyphenyl)methyl]-5-phenyl-4,5-dihydroimidazol-3-ium-4-carboxylate.
| Compound Name | methyl 1-butyl-3-[(4-methoxyphenyl)methyl]-5-phenyl-4,5-dihydroimidazol-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 135021740 |
| Molecular Formula | C23H29N2O3+ |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | methyl 1-butyl-3-[(4-methoxyphenyl)methyl]-5-phenyl-4,5-dihydroimidazol-3-ium-4-carboxylate |
| SMILES | CCCCN1C=[N+](Cc2ccc(OC)cc2)C(C(=O)OC)C1c1ccccc1 |
| InChI | InChI=1S/C23H29N2O3/c1-4-5-15-24-17-25(16-18-11-13-20(27-2)14-12-18)22(23(26)28-3)21(24)19-9-7-6-8-10-19/h6-14,17,21-22H,4-5,15-16H2,1-3H3/q+1 |
| InChIKey | JVDMPOSZJIOOMM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|