C19H26O4 — CID 135022301
methyl (E)-4-[(3aS,3bR,5R,6aS,7aS)-5-methoxy-1,3a-dimethyl-3-oxo-3b,4,5,6,6a,7-hexahydrocyclopenta[a]pentalen-7a-yl]but-2-enoate (PubChem CID 135022301) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl (E)-4-[(3aS,3bR,5R,6aS,7aS)-5-methoxy-1,3a-dimethyl-3-oxo-3b,4,5,6,6a,7-hexahydrocyclopenta[a]pentalen-7a-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[(3aS,3bR,5R,6aS,7aS)-5-methoxy-1,3a-dimethyl-3-oxo-3b,4,5,6,6a,7-hexahydrocyclopenta[a]pentalen-7a-yl]but-2-enoate |
|---|---|
| PubChem CID | 135022301 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl (E)-4-[(3aS,3bR,5R,6aS,7aS)-5-methoxy-1,3a-dimethyl-3-oxo-3b,4,5,6,6a,7-hexahydrocyclopenta[a]pentalen-7a-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/C[C@@]12C[C@H]3C[C@@H](OC)C[C@H]3[C@]1(C)C(=O)C=C2C |
| InChI | InChI=1S/C19H26O4/c1-12-8-16(20)18(2)15-10-14(22-3)9-13(15)11-19(12,18)7-5-6-17(21)23-4/h5-6,8,13-15H,7,9-11H2,1-4H3/b6-5+/t13-,14-,15-,18-,19+/m1/s1 |
| InChIKey | AFSMXKHMMVJUQQ-ZZLDGVPQSA-N |
| XLogP | 3.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|