C16H22O3 — CID 135023346
[(1S,6R,9R)-8-propyl-12-oxatricyclo[7.2.1.01,6]dodeca-7,10-dien-7-yl] acetate (PubChem CID 135023346) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is [(1S,6R,9R)-8-propyl-12-oxatricyclo[7.2.1.01,6]dodeca-7,10-dien-7-yl] acetate.
| Compound Name | [(1S,6R,9R)-8-propyl-12-oxatricyclo[7.2.1.01,6]dodeca-7,10-dien-7-yl] acetate |
|---|---|
| PubChem CID | 135023346 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | [(1S,6R,9R)-8-propyl-12-oxatricyclo[7.2.1.01,6]dodeca-7,10-dien-7-yl] acetate |
| SMILES | CCCC1=C(OC(C)=O)[C@@H]2CCCC[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C16H22O3/c1-3-6-12-14-8-10-16(19-14)9-5-4-7-13(16)15(12)18-11(2)17/h8,10,13-14H,3-7,9H2,1-2H3/t13-,14+,16-/m0/s1 |
| InChIKey | ZSTDVIYBFXAVQO-LZWOXQAQSA-N |
| XLogP | 3.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|