C17H22O3 — CID 102105211
[(1S,8S,9R)-8-but-3-enyl-12-oxatricyclo[7.2.1.01,6]dodeca-6,10-dien-7-yl] acetate (PubChem CID 102105211) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is [(1S,8S,9R)-8-but-3-enyl-12-oxatricyclo[7.2.1.01,6]dodeca-6,10-dien-7-yl] acetate.
| Compound Name | [(1S,8S,9R)-8-but-3-enyl-12-oxatricyclo[7.2.1.01,6]dodeca-6,10-dien-7-yl] acetate |
|---|---|
| PubChem CID | 102105211 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [(1S,8S,9R)-8-but-3-enyl-12-oxatricyclo[7.2.1.01,6]dodeca-6,10-dien-7-yl] acetate |
| SMILES | C=CCC[C@@H]1C(OC(C)=O)=C2CCCC[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C17H22O3/c1-3-4-7-13-15-9-11-17(20-15)10-6-5-8-14(17)16(13)19-12(2)18/h3,9,11,13,15H,1,4-8,10H2,2H3/t13-,15+,17-/m0/s1 |
| InChIKey | KNCWXRIDYYPYQY-LXZKKBNFSA-N |
| XLogP | 3.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|