C14H20O3 — CID 140504010
2-[(E)-2-cyclohexylethenyl]-4-methoxy-2,3-dihydropyran-6-one (PubChem CID 140504010) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-[(E)-2-cyclohexylethenyl]-4-methoxy-2,3-dihydropyran-6-one.
| Compound Name | 2-[(E)-2-cyclohexylethenyl]-4-methoxy-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 140504010 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-[(E)-2-cyclohexylethenyl]-4-methoxy-2,3-dihydropyran-6-one |
| SMILES | COC1=CC(=O)OC(/C=C/C2CCCCC2)C1 |
| InChI | InChI=1S/C14H20O3/c1-16-13-9-12(17-14(15)10-13)8-7-11-5-3-2-4-6-11/h7-8,10-12H,2-6,9H2,1H3/b8-7+ |
| InChIKey | YEFKXONLQGLDNO-BQYQJAHWSA-N |
| XLogP | 2.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|