C19H22O2 — CID 135023505
(1R,6R,8R)-2-phenylmethoxytricyclo[6.2.2.01,6]dodec-11-en-9-one (PubChem CID 135023505) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (1R,6R,8R)-2-phenylmethoxytricyclo[6.2.2.01,6]dodec-11-en-9-one.
| Compound Name | (1R,6R,8R)-2-phenylmethoxytricyclo[6.2.2.01,6]dodec-11-en-9-one |
|---|---|
| PubChem CID | 135023505 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (1R,6R,8R)-2-phenylmethoxytricyclo[6.2.2.01,6]dodec-11-en-9-one |
| SMILES | O=C1C[C@]23C=C[C@H]1C[C@H]2CCCC3OCc1ccccc1 |
| InChI | InChI=1S/C19H22O2/c20-17-12-19-10-9-15(17)11-16(19)7-4-8-18(19)21-13-14-5-2-1-3-6-14/h1-3,5-6,9-10,15-16,18H,4,7-8,11-13H2/t15-,16+,18?,19+/m0/s1 |
| InChIKey | OHIDGZIJERPEPZ-KGSXOFGPSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|