C16H24O4 — CID 135023529
methyl (2E,4Z)-4-acetyloxy-6,10-dimethylundeca-2,4,9-trienoate (PubChem CID 135023529) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl (2E,4Z)-4-acetyloxy-6,10-dimethylundeca-2,4,9-trienoate.
| Compound Name | methyl (2E,4Z)-4-acetyloxy-6,10-dimethylundeca-2,4,9-trienoate |
|---|---|
| PubChem CID | 135023529 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl (2E,4Z)-4-acetyloxy-6,10-dimethylundeca-2,4,9-trienoate |
| SMILES | COC(=O)/C=C/C(=C/C(C)CCC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C16H24O4/c1-12(2)7-6-8-13(3)11-15(20-14(4)17)9-10-16(18)19-5/h7,9-11,13H,6,8H2,1-5H3/b10-9+,15-11- |
| InChIKey | IBVKYPXNCAYOIA-RKVFCIRRSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|