C10H13F3O — CID 135023914
1,1,1-trifluoro-5,5-dimethyloct-7-en-2-yn-4-ol (PubChem CID 135023914) has the molecular formula C10H13F3O and a molecular weight of 206.21 g/mol. Its IUPAC name is 1,1,1-trifluoro-5,5-dimethyloct-7-en-2-yn-4-ol.
| Compound Name | 1,1,1-trifluoro-5,5-dimethyloct-7-en-2-yn-4-ol |
|---|---|
| PubChem CID | 135023914 |
| Molecular Formula | C10H13F3O |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1,1,1-trifluoro-5,5-dimethyloct-7-en-2-yn-4-ol |
| SMILES | C=CCC(C)(C)C(O)C#CC(F)(F)F |
| InChI | InChI=1S/C10H13F3O/c1-4-6-9(2,3)8(14)5-7-10(11,12)13/h4,8,14H,1,6H2,2-3H3 |
| InChIKey | YXYBNVCDZNBECU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|