C16H28O5 — CID 135024214
methyl (1R,2S,4S)-2-[(E)-6-hydroxyhept-1-enyl]-4-(methoxymethoxy)cyclopentane-1-carboxylate (PubChem CID 135024214) has the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. Its IUPAC name is methyl (1R,2S,4S)-2-[(E)-6-hydroxyhept-1-enyl]-4-(methoxymethoxy)cyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,4S)-2-[(E)-6-hydroxyhept-1-enyl]-4-(methoxymethoxy)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 135024214 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | methyl (1R,2S,4S)-2-[(E)-6-hydroxyhept-1-enyl]-4-(methoxymethoxy)cyclopentane-1-carboxylate |
| SMILES | COCO[C@H]1C[C@@H](/C=C/CCCC(C)O)[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C16H28O5/c1-12(17)7-5-4-6-8-13-9-14(21-11-19-2)10-15(13)16(18)20-3/h6,8,12-15,17H,4-5,7,9-11H2,1-3H3/b8-6+/t12?,13-,14+,15-/m1/s1 |
| InChIKey | LSIROTSFUXPKKQ-FBZMTBDDSA-N |
| XLogP | 2.28 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|