C17H28O6 — CID 135024642
[3-acetyloxy-6-(5-methylhexan-2-yloxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 135024642) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [3-acetyloxy-6-(5-methylhexan-2-yloxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-6-(5-methylhexan-2-yloxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135024642 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [3-acetyloxy-6-(5-methylhexan-2-yloxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)CCC(C)C)C=CC1OC(C)=O |
| InChI | InChI=1S/C17H28O6/c1-11(2)6-7-12(3)21-17-9-8-15(22-14(5)19)16(23-17)10-20-13(4)18/h8-9,11-12,15-17H,6-7,10H2,1-5H3 |
| InChIKey | IFUNKBQNLBJAJH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|