C18H27NO2 — CID 135024766
2-methyl-2-[(3,4,5,5-tetramethyl-4-phenyloxolan-2-ylidene)amino]propan-1-ol (PubChem CID 135024766) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-methyl-2-[(3,4,5,5-tetramethyl-4-phenyloxolan-2-ylidene)amino]propan-1-ol.
| Compound Name | 2-methyl-2-[(3,4,5,5-tetramethyl-4-phenyloxolan-2-ylidene)amino]propan-1-ol |
|---|---|
| PubChem CID | 135024766 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-methyl-2-[(3,4,5,5-tetramethyl-4-phenyloxolan-2-ylidene)amino]propan-1-ol |
| SMILES | CC1/C(=N/C(C)(C)CO)OC(C)(C)C1(C)c1ccccc1 |
| InChI | InChI=1S/C18H27NO2/c1-13-15(19-16(2,3)12-20)21-17(4,5)18(13,6)14-10-8-7-9-11-14/h7-11,13,20H,12H2,1-6H3/b19-15- |
| InChIKey | BETPPCOEMJGYJM-CYVLTUHYSA-N |
| XLogP | 3.56 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|