C15H19NO2 — CID 11770706
(1S,2S)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-phenylbut-3-en-1-ol (PubChem CID 11770706) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (1S,2S)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-phenylbut-3-en-1-ol.
| Compound Name | (1S,2S)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-phenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 11770706 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (1S,2S)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-phenylbut-3-en-1-ol |
| SMILES | C=C[C@@H](c1ccccc1)[C@H](O)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C15H19NO2/c1-4-12(11-8-6-5-7-9-11)13(17)14-16-15(2,3)10-18-14/h4-9,12-13,17H,1,10H2,2-3H3/t12-,13-/m0/s1 |
| InChIKey | DSRXQAMTZPYLIC-STQMWFEESA-N |
| XLogP | 2.52 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|