C16H21NO2 — CID 134998900
2-[(2S)-2-benzyl-3,3-dimethyloxiran-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 134998900) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-[(2S)-2-benzyl-3,3-dimethyloxiran-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(2S)-2-benzyl-3,3-dimethyloxiran-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 134998900 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 2-[(2S)-2-benzyl-3,3-dimethyloxiran-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC([C@@]2(Cc3ccccc3)OC2(C)C)=N1 |
| InChI | InChI=1S/C16H21NO2/c1-14(2)11-18-13(17-14)16(15(3,4)19-16)10-12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3/t16-/m1/s1 |
| InChIKey | HWBBFCJNCXCXNH-MRXNPFEDSA-N |
| XLogP | 2.98 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|