C15H19NO2 — CID 134931420
(Z,1S)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-phenylbut-2-en-1-ol (PubChem CID 134931420) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (Z,1S)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-phenylbut-2-en-1-ol.
| Compound Name | (Z,1S)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-phenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 134931420 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (Z,1S)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-phenylbut-2-en-1-ol |
| SMILES | CC1(C)COC([C@@H](O)/C=C\Cc2ccccc2)=N1 |
| InChI | InChI=1S/C15H19NO2/c1-15(2)11-18-14(16-15)13(17)10-6-9-12-7-4-3-5-8-12/h3-8,10,13,17H,9,11H2,1-2H3/b10-6-/t13-/m0/s1 |
| InChIKey | DCWCSZRKNVIMRK-HKBVPSITSA-N |
| XLogP | 2.35 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|