C15H19NO2 — CID 11118305
2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-phenylbut-3-en-2-ol (PubChem CID 11118305) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-phenylbut-3-en-2-ol.
| Compound Name | 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-phenylbut-3-en-2-ol |
|---|---|
| PubChem CID | 11118305 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-phenylbut-3-en-2-ol |
| SMILES | C=C(c1ccccc1)C(C)(O)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C15H19NO2/c1-11(12-8-6-5-7-9-12)15(4,17)13-16-14(2,3)10-18-13/h5-9,17H,1,10H2,2-4H3 |
| InChIKey | LCFZLMKPITWIRB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |