C26H30N2O4 — CID 135024581
(E)-1,4-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,4-diphenylbut-2-ene-1,4-diol (PubChem CID 135024581) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is (E)-1,4-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,4-diphenylbut-2-ene-1,4-diol.
| Compound Name | (E)-1,4-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,4-diphenylbut-2-ene-1,4-diol |
|---|---|
| PubChem CID | 135024581 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (E)-1,4-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,4-diphenylbut-2-ene-1,4-diol |
| SMILES | CC1(C)COC(C(O)(/C=C/C(O)(C2=NC(C)(C)CO2)c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C26H30N2O4/c1-23(2)17-31-21(27-23)25(29,19-11-7-5-8-12-19)15-16-26(30,20-13-9-6-10-14-20)22-28-24(3,4)18-32-22/h5-16,29-30H,17-18H2,1-4H3/b16-15+ |
| InChIKey | RIIRVSXSBADKMA-FOCLMDBBSA-N |
| XLogP | 3.73 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|