C30H31FeNO2 — CID 134992078
CID 134992078 (PubChem CID 134992078) has the molecular formula C30H31FeNO2 and a molecular weight of 493.43 g/mol.
| Compound Name | CID 134992078 |
|---|---|
| PubChem CID | 134992078 |
| Molecular Formula | C30H31FeNO2 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[C@H]1COC([C]2[CH][CH][CH][CH]2)=N1.OC([C]1[CH][CH][CH][CH]1)(c1ccccc1)c1ccccc1.[Fe] |
| InChI | InChI=1S/C18H15O.C12H16NO.Fe/c19-18(17-13-7-8-14-17,15-9-3-1-4-10-15)16-11-5-2-6-12-16;1-12(2,3)10-8-14-11(13-10)9-6-4-5-7-9;/h1-14,19H;4-7,10H,8H2,1-3H3;/t;10-;/m.1./s1 |
| InChIKey | JQQMHOPJMWWOAV-ZKYZXAGVSA-N |
| XLogP | 5.56 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|