C22H25NO3 — CID 134998895
2-[(2S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3,3-diphenyloxiran-2-yl]propan-2-ol (PubChem CID 134998895) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[(2S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3,3-diphenyloxiran-2-yl]propan-2-ol.
| Compound Name | 2-[(2S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3,3-diphenyloxiran-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 134998895 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 2-[(2S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3,3-diphenyloxiran-2-yl]propan-2-ol |
| SMILES | CC1(C)COC([C@@]2(C(C)(C)O)OC2(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C22H25NO3/c1-19(2)15-25-18(23-19)22(20(3,4)24)21(26-22,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,24H,15H2,1-4H3/t22-/m0/s1 |
| InChIKey | AQZVUDWMQSBEAT-QFIPXVFZSA-N |
| XLogP | 3.68 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|