C18H27NO2Si — CID 15536655
[(2S,3R)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methyl-2-(4-methylphenyl)oxiran-2-yl]-trimethylsilane (PubChem CID 15536655) has the molecular formula C18H27NO2Si and a molecular weight of 317.51 g/mol. Its IUPAC name is [(2S,3R)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methyl-2-(4-methylphenyl)oxiran-2-yl]-trimethylsilane.
| Compound Name | [(2S,3R)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methyl-2-(4-methylphenyl)oxiran-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 15536655 |
| Molecular Formula | C18H27NO2Si |
| Molecular Weight | 317.51 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | [(2S,3R)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methyl-2-(4-methylphenyl)oxiran-2-yl]-trimethylsilane |
| SMILES | Cc1ccc([C@@]2([Si](C)(C)C)O[C@]2(C)C2=NC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C18H27NO2Si/c1-13-8-10-14(11-9-13)18(22(5,6)7)17(4,21-18)15-19-16(2,3)12-20-15/h8-11H,12H2,1-7H3/t17-,18+/m1/s1 |
| InChIKey | WFYNTVDCXKSHGB-MSOLQXFVSA-N |
| XLogP | 4.06 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|