C13H17NO2 — CID 146018737
(4S,5S)-5-butyl-3-phenyl-4,5-dihydro-1,2-oxazol-4-ol (PubChem CID 146018737) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (4S,5S)-5-butyl-3-phenyl-4,5-dihydro-1,2-oxazol-4-ol.
| Compound Name | (4S,5S)-5-butyl-3-phenyl-4,5-dihydro-1,2-oxazol-4-ol |
|---|---|
| PubChem CID | 146018737 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (4S,5S)-5-butyl-3-phenyl-4,5-dihydro-1,2-oxazol-4-ol |
| SMILES | CCCC[C@@H]1ON=C(c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C13H17NO2/c1-2-3-9-11-13(15)12(14-16-11)10-7-5-4-6-8-10/h4-8,11,13,15H,2-3,9H2,1H3/t11-,13+/m0/s1 |
| InChIKey | KEDWLAOMOZZMIC-WCQYABFASA-N |
| XLogP | 2.34 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |