C14H13NO2 — CID 9924
2-hydroxyimino-1,2-diphenylethanol (PubChem CID 9924) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-hydroxyimino-1,2-diphenylethanol.
| Compound Name | 2-hydroxyimino-1,2-diphenylethanol |
|---|---|
| PubChem CID | 9924 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-hydroxyimino-1,2-diphenylethanol |
| SMILES | ON=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H13NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,14,16-17H |
| InChIKey | WAKHLWOJMHVUJC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|